Online Inquiry
1-Bromo-2-methylbutane
| Catalog Number | ACM5973115 |
| CAS | 5973-11-5 |
| Structure |  |
| IUPAC Name | 1-bromo-2-methylbutane |
| Synonyms | 1-BROMO-2-METHYLBUTANE;10422-35-2;Butane, 1-bromo-2-methyl-;5973-11-5;1-Bromo-2-methyl butane;d-Amyl bromide;2-Methylbutyl Bromide;(+)-2-Methylbutyl bromide;1-Bromo-2-methyl-butane;2-methylbromobutane;ACMC-20aphf;2-methyl-1-bromobutane;1-Bromo 2 methylbutane;1-bromo--2-methylbutane;(+)-2-methylbutylbromide;d-1-Bromo-2-methylbutane;(+) 2-methylbutyl bromide;1-bromanyl-2-methyl-butane;DL-1-Bromo-2-methylbutane;SCHEMBL115533;(1)-1-Bromo-2-methylbutane;CHEMBL156329;DTXSID50870593;(+/-)-1-bromo-2-methyl butane;AMY28688;Butane, 1-bromo-2-methyl-, DL-;EINECS 227-768-1;1-Bromo-2-methylbutane, AldrichCPR;ANW-15051;MFCD00000218;SBB007669;AKOS009158562;MCULE-5451416952;AS-44338;Butane, 1-bromo-2-methyl-, (.+/-.)-;DB-080873;FT-0607461;FT-0660757;X6081;A800932;J-504403;Q27271981 |
| Molecular Weight | 151.04g/mol |
| Molecular Formula | C5H11Br |
| Canonical SMILES | CCC(C)CBr |
| InChI | InChI=1S/C5H11Br/c1-3-5(2)4-6/h5H,3-4H2,1-2H3 |
| InChI Key | XKVLZBNEPALHIO-UHFFFAOYSA-N |
| Complexity | 27.1 |
| Covalently-Bonded Unit Count | 1 |
| EC Number | 227-768-1;600-538-1 |
| Exact Mass | 150.00441g/mol |
| Heavy Atom Count | 6 |
| Hydrogen Bond Acceptor Count | 0 |
| Monoisotopic Mass | 150.00441g/mol |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 0Ų |
| X Log P3 | 2.7 |
Please kindly note that our products and services are for research use only.