| Catalog Number |
ACM262297132 |
| CAS |
262297-13-2 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/262297-13-2.gif) |
| IUPAC Name |
1-butyl-3-methylimidazol-3-ium;hydrogen sulfate |
| Synonyms |
BMIMHSO4 |
| Molecular Weight |
236.29 |
| Molecular Formula |
C8H16N2O4S |
| Canonical SMILES |
CCCCN1C=C[N+](=C1)C.OS(=O)(=O)[O-] |
| InChI |
1S/C8H15N2.H2O4S/c1-3-4-5-10-7-6-9(2)8-10;1-5(2,3)4/h6-8H,3-5H2,1-2H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChI Key |
KXCVJPJCRAEILX-UHFFFAOYSA-M |
| Melting Point |
~70 °C |
| Flash Point |
543.2 °F |
| Purity |
>97.0%(HPLC)(N) |
| Solubility |
soluble in Methanol |
| Appearance |
Colorless to Red to Green clear liquid |
| Application |
Metal Plating, Electropolishing, Metal Reprocessing, Phase transfer media, Batteries Fuel Cells, Nanomaterials, Industrial Solvents, Nuclear Fuel Red Waste, Enzymatic Catalysis, Lubricants Heat Transfer and Solar Energy Conversion. |
| Storage |
Store under inert gas, -20℃ |
| Complexity |
169 |
| Covalently-Bonded Unit Count |
2 |
| Exact Mass |
236.08307817g/mol |
| Hazard Statements |
H314 : Causes severe skin burns and eye damage.H290 : May be corrosive to metals. |
| Heavy Atom Count |
15 |
| Hydrogen Bond Acceptor Count |
4 |
| MDL Number |
MFCD06798197 |
| Monoisotopic Mass |
236.08307817g/mol |
| Refractive Index |
n20/D 1.41 |
| Rotatable Bond Count |
3 |
| Topological Polar Surface Area |
94.6Ų |