1-Ethylnaphthalene
| Catalog Number |
ACM1127760 |
| CAS |
1127-76-0 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/1127-76-0.gif) |
| IUPAC Name |
1-ethylnaphthalene |
| Synonyms |
Naphthalene, 1-ethyl- |
| Molecular Weight |
156.22 |
| Molecular Formula |
C12H12 |
| Canonical SMILES |
CCC1=CC=CC2=CC=CC=C21 |
| InChI |
InChI=1S/C12H12/c1-2-10-7-5-8-11-6-3-4-9-12(10)11/h3-9H,2H2,1H3 |
| InChI Key |
ZMXIYERNXPIYFR-UHFFFAOYSA-N |
| Purity |
99% |
| Complexity |
139 |
| Covalently-Bonded Unit Count |
1 |
| EC Number |
214-432-4 |
| Exact Mass |
156.0939 |
| Heavy Atom Count |
12 |
| Hydrogen Bond Acceptor Count |
0 |
| Monoisotopic Mass |
156.0939 |
| NSC Number |
59390 |
| Rotatable Bond Count |
1 |
| Topological Polar Surface Area |
0 Ų |
| UNII |
P1MIE8TZ19 |
| X Log P3 |
4.4 |
Please kindly note that our products and services are for research use only.