Online Inquiry
1-Tetrahydrofurfuryl-piperazine
| Catalog Number | ACM82500354 |
| CAS | 82500-35-4 |
| Structure |  |
| IUPAC Name | 1-(oxolan-2-ylmethyl)piperazine |
| Synonyms | 1-Tetrahydrofurfuryl-piperazine;82500-35-4;1-((Tetrahydrofuran-2-yl)methyl)piperazine;1-(tetrahydrofurfuryl)piperazine;1-(oxolan-2-ylmethyl)piperazine;1-(Tetrahydro-furan-2-ylmethyl)-piperazine;1-(Tetrahydro-2-furylmethyl)piperazine;1-(tetrahydrofuran-2-ylmethyl)piperazine;1-tetrahydrofurfurylpiperazine;MFCD02093558;2-(piperazinylmethyl)oxolane;1-[(oxolan-2-yl)methyl]piperazine;ACMC-1BJEO;C14H6NNaO7S;SCHEMBL487732;1-(2-oxolanylmethyl)piperazine;CHEMBL4525170;DTXSID10371955;2-(Piperazinomethyl)tetrahydrofuran;STR10028;0192AF;2757AC;KM2121;SBB010068;AKOS000118591;AKOS016040163;CS-W004005;MCULE-5377402762;VP70223;TS-02317;1-(tetrahydrofuran-2-ylmethyl)-piperazine;DB-017728;FT-0641870;FT-0643475;ST50274177;A840359;1-(Tetrahydro-2-furylmethyl)piperazine, >=98.0% |
| Molecular Weight | 170.25g/mol |
| Molecular Formula | C9H18N2O |
| Canonical SMILES | C1CC(OC1)CN2CCNCC2 |
| InChI | InChI=1S/C9H18N2O/c1-2-9(12-7-1)8-11-5-3-10-4-6-11/h9-10H,1-8H2 |
| InChI Key | GKBPGHNDWVURBD-UHFFFAOYSA-N |
| Boiling Point | 143-148ºC 3mm |
| Flash Point | 116.557ºC |
| Purity | >98 |
| Density | 1.02g/cm³ |
| Complexity | 135 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 170.141913202g/mol |
| Hazard Statements | Xi: Irritant; |
| Heavy Atom Count | 12 |
| Hydrogen Bond Acceptor Count | 3 |
| Monoisotopic Mass | 170.141913202g/mol |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 24.5Ų |
| WGK Germany | 3 |
| X Log P3 | 0 |
Please kindly note that our products and services are for research use only.