1H-Pyrrole-2-carboxylic acid, 4-methyl-, methyl ester
| Catalog Number |
ACM34402783-1 |
| CAS |
34402-78-3 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/acm34402783.gif) |
| IUPAC Name |
Methyl 4-methyl-1H-pyrrole-2-carboxylate |
| Molecular Weight |
139.15 |
| Molecular Formula |
C7H9NO2 |
| Canonical SMILES |
CC1=CNC(=C1)C(=O)OC |
| InChI |
InChI=1S/C7H9NO2/c1-5-3-6(8-4-5)7(9)10-2/h3-4,8H,1-2H3 |
| InChI Key |
BMCUQYLZVGVDCW-UHFFFAOYSA-N |
| Complexity |
136 |
| Exact Mass |
139.063328530 |
| Heavy Atom Count |
10 |
| Monoisotopic Mass |
139.063328530 |
| Topological Polar Surface Area |
42.1Ų |
Please kindly note that our products and services are for research use only.