Online Inquiry
2-(4-Aminocyclohexyl)ethanol
| Catalog Number | ACM857831266 |
| CAS | 857831-26-6 |
| Structure |  |
| IUPAC Name | 2-(4-aminocyclohexyl)ethanol |
| Synonyms | 2-(4-Aminocyclohexyl)ethanol;857831-26-6;4-Aminocyclohexaneethanol;2-(4-Aminocyclohexyl)ethan-1-ol;trans-4-amino-cyclohexaneethanol;MFCD15072144;trans- 4-amino-cyclohexaneethanol;506428-44-0;Cyclohexaneethanol, 4-amino-;4-(2-Hydroxyethyl)cyclohexanamine;cis-4-Amino-cyclohexaneethanol;SCHEMBL3779872;SCHEMBL4088177;trans- 4-mino-yclohexaneethanol;SCHEMBL18995729;DTXSID10612219;ZINC72099145;AKOS006337763;AKOS006348263;trans-2-(4-amino-cyclohexyl)-ethanol;ZINC307068721;1-Amino-4-(2-hydroxyethyl)cyclohexane;SB23095;AK-68022;DS-16856;SY035979;2-(4-Aminocyclohexyl)ethanol, AldrichCPR;DB-128821;2-[(1S,4s)-4-aminocyclohexyl]ethan-1-ol;4-Aminocyclohexaneethanol (cis- and trans- mixture);1508307-49-0 |
| Molecular Weight | 143.23g/mol |
| Molecular Formula | C8H17NO |
| Canonical SMILES | C1CC(CCC1CCO)N |
| InChI | InChI=1S/C8H17NO/c9-8-3-1-7(2-4-8)5-6-10/h7-8,10H,1-6,9H2 |
| InChI Key | XLKSLYGRARRUJP-UHFFFAOYSA-N |
| Complexity | 87.3 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 143.131014166g/mol |
| Heavy Atom Count | 10 |
| Hydrogen Bond Acceptor Count | 2 |
| Monoisotopic Mass | 143.131014166g/mol |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 46.2Ų |
| X Log P3 | 0.5 |
Please kindly note that our products and services are for research use only.