Online Inquiry
2,6-Dichloro-4-iodopyridine
| Catalog Number | ACM98027840 |
| CAS | 98027-84-0 |
| Structure |  |
| IUPAC Name | 2,6-dichloro-4-iodopyridine |
| Synonyms | 2,6-Dichloro-4-iodopyridine;98027-84-0;2,6-dichloro-4-iodo-pyridine;2 6-dichloro-4-iodopyridine;MFCD07368400;PYRIDINE, 2,6-DICHLORO-4-IODO-;PubChem17648;SCHEMBL363319;2,6 dichloro-4-iodo pyridine;2,6-Dichloro-4-iodopyridine,;DTXSID00471453;ACT01415;BCP03577;CS-D1682;EBD16995;4-IODO-2,6-DICHLOROPYRIDINE;ANW-49537;BBL101271;STL555067;ZINC12359322;2,6-Dichloro-4-iodopyridine, 97%;AKOS005257743;AB32018;GS-5875;LS20633;QC-9441;AC-26248;AK-23577;SY019485;AB0031192;DB-000817;AM20061785;BB 0261950;D4774;FT-0682253;X4188;A11245;C-6389;027D840;J-507432 |
| Molecular Weight | 273.88g/mol |
| Molecular Formula | C5H2Cl2IN |
| Canonical SMILES | C1=C(C=C(N=C1Cl)Cl)I |
| InChI | InChI=1S/C5H2Cl2IN/c6-4-1-3(8)2-5(7)9-4/h1-2H |
| InChI Key | NGSKFMPSBUAUNE-UHFFFAOYSA-N |
| Complexity | 91 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 272.86090g/mol |
| Heavy Atom Count | 9 |
| Hydrogen Bond Acceptor Count | 1 |
| Monoisotopic Mass | 272.86090g/mol |
| Rotatable Bond Count | 0 |
| Topological Polar Surface Area | 12.9Ų |
| X Log P3 | 3.4 |
Please kindly note that our products and services are for research use only.