Online Inquiry
2-Fluorophenyl cyclopentyl ketone
| Catalog Number | ACM111982457 |
| CAS | 111982-45-7 |
| Structure |  |
| IUPAC Name | cyclopentyl-(2-fluorophenyl)methanone |
| Synonyms | 2-FLUOROPHENYL CYCLOPENTYL KETONE;111982-45-7;cyclopentyl(2-fluorophenyl)methanone;Methanone, cyclopentyl(2-fluorophenyl)-;Cyclopentyl-(2-fluorophenyl)methanone;C12H13FO;MFCD03841320;Cyclopentyl-(2-fluoro-phenyl)-methanone;ACMC-1CI7N;SCHEMBL4006843;DTXSID20548979;ZINC2514374;8900AC;Methanone,cyclopentyl(2-fluorophenyl);AKOS011792497;MCULE-6146414131;NE29057;AK184189;DS-10022;Z1421986171 |
| Molecular Weight | 192.23g/mol |
| Molecular Formula | C12H13FO |
| Canonical SMILES | C1CCC(C1)C(=O)C2=CC=CC=C2F |
| InChI | InChI=1S/C12H13FO/c13-11-8-4-3-7-10(11)12(14)9-5-1-2-6-9/h3-4,7-9H,1-2,5-6H2 |
| InChI Key | SAVZOQLBNNRMNY-UHFFFAOYSA-N |
| Complexity | 208 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 192.095043196g/mol |
| Heavy Atom Count | 14 |
| Hydrogen Bond Acceptor Count | 2 |
| Monoisotopic Mass | 192.095043196g/mol |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 17.1Ų |
| X Log P3 | 3.2 |
Please kindly note that our products and services are for research use only.