Online Inquiry
4-(1-Adamantyl)phenol
| Catalog Number | ACM29799073 |
| CAS | 29799-07-3 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/29799-07-3.gif) |
| IUPAC Name | 4-(1-adamantyl)phenol |
| Synonyms | 4-(1-Adamantyl)phenol, AdP cpd, Ambap6144, Oprea1_143547, 393479_ALDRICH, NSC111653, AIDS126464, AIDS-126464, ZINC03864931, NSC 111653, ST5435282, C432591, 29799-07-3 |
| Molecular Weight | 228.33 |
| Molecular Formula | C16H20O |
| Canonical SMILES | C1C2CC3CC1CC(C2)(C3)C4=CC=C(C=C4)O |
| InChI Key | KZMYFIUFUAOZHP-UHFFFAOYSA-N |
| Boiling Point | 361.6ºC at 760 mmHg |
| Melting Point | 181-183ºC(lit.) |
| Flash Point | 190.3ºC |
| Purity | >95.0%(GC) |
| Density | 1.16 g/cm³ |
| Appearance | white powder. |
| Exact Mass | 228.15100 |
| Hazard Statements | Xi: Irritant; |
| WGK Germany | 3 |
Please kindly note that our products and services are for research use only.