Online Inquiry
(5-Fluorobenzofuran-2-yl)boronic acid
| Catalog Number | ACM473416330 |
| CAS | 473416-33-0 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/473416-33-0.gif) |
| IUPAC Name | (5-fluoro-1-benzofuran-2-yl)boronic acid |
| Synonyms | (5-Fluorobenzofuran-2-yl)boronic acid;473416-33-0;(5-fluoro-1-benzofuran-2-yl)boronic acid;SCHEMBL2861393;5-fluorobenzofuran-2-ylboronic acid;MFCD18383019;5-Fluoro-2-benzo[b]furanboronic Acid;AKOS024259037;ZINC169747528;CS-W007009;AK158884;AS-55572;DB-107634 |
| Molecular Weight | 179.94g/mol |
| Molecular Formula | C8H6BFO3 |
| Canonical SMILES | B(C1=CC2=C(O1)C=CC(=C2)F)(O)O |
| InChI | InChI=1S/C8H6BFO3/c10-6-1-2-7-5(3-6)4-8(13-7)9(11)12/h1-4,11-12H |
| InChI Key | YGLIPSIVUHENTJ-UHFFFAOYSA-N |
| Complexity | 190 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 180.0394024g/mol |
| Heavy Atom Count | 13 |
| Hydrogen Bond Acceptor Count | 4 |
| Monoisotopic Mass | 180.0394024g/mol |
| Rotatable Bond Count | 1 |
| Topological Polar Surface Area | 53.6Ų |
Please kindly note that our products and services are for research use only.