Online Inquiry
6-Methoxy-1H-indole-2-carboxylic acid
| Catalog Number | ACM16732733-1 |
| CAS | 16732-73-3 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/16732-73-3.gif) |
| IUPAC Name | 6-methoxy-1H-indole-2-carboxylic acid |
| Synonyms | 6-Methoxyindole-2-carboxylic acid;16732-73-3;6-Methoxy-1H-indole-2-carboxylic acid;1h-indole-2-carboxylic acid, 6-methoxy-;MFCD01548823;NSC27988;PubChem1703;zlchem 1017;BAS 06489245;Oprea1_070191;SCHEMBL335655;AKOS JY2082559;DTXSID10328449;ZLD0483;OTAVA-BB 1149688;HMS3446G14;ZINC489014;ACT02556;ALBB-006745;BCP30958;ANW-50665;BBL020243;NSC-27988;SBB027659;STK500600;AKOS000300045;Indole-2-carboxylic acid, 6-methoxy-;AC-9837;AS-5463;AS02120;ASINEX-REAG BAS 06489245;CCG-139914;CS-W007863;LS20609;MCULE-9779495169;VI30078;6-methoxy-1 h-indole-2-carboxylic acid;6-Methoxyindole-2-carboxylic acid, 95%;AK-27758;N788;6-Methoxy-1H-indole-2-carboxylic acid #;AB0001744;DB-031805;AM20030122;BB 0237257;FT-0637414;ST50280163;EN300-15092;M-2389;732M733;Q-101970;F2158-0744;Z361993804 |
| Molecular Weight | 191.18g/mol |
| Molecular Formula | C10H9NO3 |
| Canonical SMILES | COC1=CC2=C(C=C1)C=C(N2)C(=O)O |
| InChI | InChI=1S/C10H9NO3/c1-14-7-3-2-6-4-9(10(12)13)11-8(6)5-7/h2-5,11H,1H3,(H,12,13) |
| InChI Key | XNBGANWAZJWOHS-UHFFFAOYSA-N |
| Complexity | 231 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 191.058243149g/mol |
| Heavy Atom Count | 14 |
| Hydrogen Bond Acceptor Count | 3 |
| Monoisotopic Mass | 191.058243149g/mol |
| NSC Number | 27988 |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 62.3Ų |
| X Log P3 | 2.3 |
Please kindly note that our products and services are for research use only.