Online Inquiry
6-Phenylhexanoic acid
| Catalog Number | ACM5581759 |
| CAS | 5581-75-9 |
| Structure |  |
| IUPAC Name | 6-phenylhexanoic acid |
| Synonyms | 6-Phenylhexanoic acid;5581-75-9;Benzenehexanoic acid;UNII-43U2R7T4EC;MFCD00014381;43U2R7T4EC;6-Phenylcaproic acid;phenyl hexanoic acid;6-phenyl-hexanoic acid;ACMC-1AP1S;6-Phenylhexanoic acid, 98%;SCHEMBL503837;DTXSID90204398;ALBB-023695;BCP24350;NSC66179;STR08043;ZINC1693228;ANW-32408;NSC-66179;SBB071719;AKOS009158917;MCULE-8701939268;DB-052807;FT-0621303;P1108;R1298;ST45026882;Q27258669 |
| Molecular Weight | 192.25g/mol |
| Molecular Formula | C12H16O2 |
| Canonical SMILES | C1=CC=C(C=C1)CCCCCC(=O)O |
| InChI | InChI=1S/C12H16O2/c13-12(14)10-6-2-5-9-11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2,(H,13,14) |
| InChI Key | JTXZPQIXIXYMDY-UHFFFAOYSA-N |
| Melting Point | 23.0 °C |
| Solubility | 0.00 M |
| Complexity | 160 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 192.115029749g/mol |
| Heavy Atom Count | 14 |
| Hydrogen Bond Acceptor Count | 2 |
| Log P | 3.27 (LogP) |
| Monoisotopic Mass | 192.115029749g/mol |
| NSC Number | 66179 |
| Rotatable Bond Count | 6 |
| Topological Polar Surface Area | 37.3Ų |
| UNII | 43U2R7T4EC |
| X Log P3 | 3.3 |
Please kindly note that our products and services are for research use only.