| Catalog Number |
ACM14436329 |
| CAS |
14436-32-9 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/14436-32-9.gif) |
| IUPAC Name |
Dec-9-enoic acid |
| Synonyms |
Caproleic acid |
| Molecular Weight |
170.25 |
| Molecular Formula |
C10H18O2 |
| Canonical SMILES |
C=CCCCCCCCC(=O)O |
| InChI |
InChI=1S/C10H18O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2H,1,3-9H2,(H,11,12) |
| InChI Key |
KHAVLLBUVKBTBG-UHFFFAOYSA-N |
| Boiling Point |
270 °C |
| Melting Point |
26.5 °C |
| Flash Point |
>230 °F |
| Purity |
98%+ |
| Density |
0.918 g/mL at 25 °C(lit.) |
| Solubility |
Insoluble in water; soluble in alcohol |
| Appearance |
Colorless to pale yellow liquid |
| Storage |
Freezer |
| Exact Mass |
170.130679813 |
| Monoisotopic Mass |
170.130679813 |
| Refractive Index |
n20/D 1.447(lit.) |
| Target Pest |
Waxy orange, reminiscent of kiwi fruit, fruity and milky, drying down to a clean cucumber / melon note. |
| Topological Polar Surface Area |
37.3 Ų |