Batatasin Iv
| Catalog Number |
ACM60347673 |
| CAS |
60347-67-3 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/60347-67-3.gif) |
| IUPAC Name |
3-[2-(2-hydroxyphenyl)ethyl]-5-methoxyphenol |
| Molecular Weight |
244.3 |
| Molecular Formula |
C15H16O3 |
| Canonical SMILES |
COC1=CC(=CC(=C1)O)CCC2=CC=CC=C2O |
| InChI |
InChI=1S/C15H16O3/c1-18-14-9-11(8-13(16)10-14)6-7-12-4-2-3-5-15(12)17/h2-5,8-10,16-17H,6-7H2,1H3 |
| InChI Key |
IUMFLNFLJUUODE-UHFFFAOYSA-N |
| Flash Point |
205.7ºC |
| Purity |
98% |
| Density |
1.198g/cm3 |
| Appearance |
Powder |
| Exact Mass |
244.11000 |
| Log P |
2.89160 |
| PSA |
49.69000 |
| Refractive Index |
1.61 |
Please kindly note that our products and services are for research use only.