Online Inquiry
Benzoin ethyl ether
| Catalog Number | ACM574094-2 |
| CAS | 574-09-4 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/574-09-4.gif) |
| IUPAC Name | 2-ethoxy-1,2-diphenylethanone |
| Synonyms | α-Ethoxy-α-phenylacetophenone, 2-Ethoxy-2-phenylacetophenone |
| Molecular Weight | 240.30 |
| Molecular Formula | C6H5COCH(OC2H5)C6H5 |
| Canonical SMILES | CCOC(C(=O)c1ccccc1)c2ccccc2 |
| InChI | 1S/C16H16O2/c1-2-18-16(14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12,16H,2H2,1H3 |
| InChI Key | KMNCBSZOIQAUFX-UHFFFAOYSA-N |
| Melting Point | 59-61 °C (lit.) |
| Flash Point | 152.3±18.1 °C |
| Purity | >99.0%(GC) |
| Density | 1.1±0.1 g/cm3 |
| Application | This product is suitable for scientific research. |
| Complexity | 250 |
| Covalently-Bonded Unit Count | 1 |
| EC Number | 209-366-8 |
| Exact Mass | 240.115036 |
| Heavy Atom Count | 18 |
| Log P | 3.90 |
| MDL Number | MFCD00009242 |
| Monoisotopic Mass | 240.11503g/mol |
| PSA | 26.30000 |
| Quality Level | 100 |
| Refractive Index | 1.561 |
| Rotatable Bond Count | 5 |
| Symbol | GHS07, GHS09 |
| Vapor Pressure | 0.0±0.8 mmHg at 25°C |
| X Log P3 | 3 |
Please kindly note that our products and services are for research use only.