BENZOIN ISOPROPYL ETHER
| Catalog Number |
ACM6652284-1 |
| CAS |
6652-28-4 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/6652-28-4.gif) |
| IUPAC Name |
1,2-diphenyl-2-propan-2-yloxyethanone |
| Molecular Weight |
254.32400 |
| Molecular Formula |
C17H18O2 |
| Canonical SMILES |
CC(C)OC(C1=CC=CC=C1)C(=O)C2=CC=CC=C2 |
| InChI |
InChI=1S/C17H18O2/c1-13(2)19-17(15-11-7-4-8-12-15)16(18)14-9-5-3-6-10-14/h3-13,17H,1-2H3 |
| InChI Key |
MSAHTMIQULFMRG-UHFFFAOYSA-N |
| Melting Point |
78-80 °C(lit.) |
| Flash Point |
152.1ºC |
| Density |
1.065 g/cm3 |
| Complexity |
273 |
| Covalently-Bonded Unit Count |
1 |
| EC Number |
229-677-2 |
| Exact Mass |
254.13100 |
| Heavy Atom Count |
19 |
| Log P |
4.03560 |
| Monoisotopic Mass |
254.13068g/mol |
| PSA |
26.30000 |
| Rotatable Bond Count |
5 |
| X Log P3 |
3.5 |
Please kindly note that our products and services are for research use only.