Online Inquiry
Benzoin methyl ether
| Catalog Number | ACM3524627-2 |
| CAS | 3524-62-7 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/3524-62-7.gif) |
| IUPAC Name | 2-methoxy-1,2-di(phenyl)ethanone |
| Synonyms | α-Methoxy-α-phenylacetophenone, 2-Methoxy-2-phenylacetophenone |
| Molecular Weight | 226.27 |
| Molecular Formula | C6H5CH(OCH3)COC6H5 |
| Canonical SMILES | COC(C(=O)c1ccccc1)c2ccccc2 |
| InChI | 1S/C15H14O2/c1-17-15(13-10-6-3-7-11-13)14(16)12-8-4-2-5-9-12/h2-11,15H,1H3 |
| InChI Key | BQZJOQXSCSZQPS-UHFFFAOYSA-N |
| Boiling Point | 188-189ºC(15 torr) |
| Melting Point | 47.5-48.5 °C (lit.) |
| Flash Point | >230 °F |
| Purity | >98.0%(GC) |
| Density | 1.128 |
| Appearance | white to off-white powder |
| Application | Photoinitiator. |
| EC Number | 222-538-7 |
| Exact Mass | 226.09900 |
| Hazard Statements | Xn:Harmful; |
| Log P | 3.25700 |
| MDL Number | MFCD00008492 |
| PSA | 26.30000 |
| Quality Level | 200 |
| Symbol | GHS06 |
| WGK Germany | 3 |
Please kindly note that our products and services are for research use only.