| Catalog Number | ACM1458576005-1 |
| CAS | 1458576-00-5 |
| IUPAC Name | 5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)-N-(3,6,9,12-tetraoxapentadec-14-yn-1-yl)pentanamide |
| Synonyms | Biotin-PEG4-alkyne |
| Molecular Weight | 457.59 g/mol |
| Molecular Formula | C21H35N3O6S |
| Canonical SMILES | O=C1N[C@@]2([H])CS[C@@H](CCCCC(NCCOCCOCCOCCOCC#C)=O)[C@@]2([H])N1 |
| InChI | InChI=1S/C21H35N3O6S/c1-2-8-27-10-12-29-14-15-30-13-11-28-9-7-22-19(25)6-4-3-5-18-20-17(16-31-18)23-21(26)24-20/h1,17-18,20H,3-16H2,(H,22,25)(H2,23,24,26)/t17-,18-,20-/m0/s1 |
| InChI Key | SKMJWNZZFUDLKQ-BJLQDIEVSA-N |
| Melting Point | 55-64 °C |
| Purity | ≥95% |
| Appearance | Solid powder |
| Application | Useful for biotinylation of reagents |
| Shelf Life | >3 years if stored properly |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| Exact Mass | 457.2247 |