| Catalog Number |
ACM1458576005-1 |
| CAS |
1458576-00-5 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/1458576-00-5.gif) |
| IUPAC Name |
5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)-N-(3,6,9,12-tetraoxapentadec-14-yn-1-yl)pentanamide |
| Synonyms |
Biotin-PEG4-alkyne |
| Molecular Weight |
457.59 g/mol |
| Molecular Formula |
C21H35N3O6S |
| Canonical SMILES |
O=C1N[C@@]2([H])CS[C@@H](CCCCC(NCCOCCOCCOCCOCC#C)=O)[C@@]2([H])N1 |
| InChI |
InChI=1S/C21H35N3O6S/c1-2-8-27-10-12-29-14-15-30-13-11-28-9-7-22-19(25)6-4-3-5-18-20-17(16-31-18)23-21(26)24-20/h1,17-18,20H,3-16H2,(H,22,25)(H2,23,24,26)/t17-,18-,20-/m0/s1 |
| InChI Key |
SKMJWNZZFUDLKQ-BJLQDIEVSA-N |
| Melting Point |
55-64 °C |
| Purity |
≥95% |
| Appearance |
Solid powder |
| Application |
Useful for biotinylation of reagents |
| Shelf Life |
>3 years if stored properly |
| Storage |
Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| Exact Mass |
457.2247 |