Catalog Number |
ACM9007209-2 |
CAS |
9007-20-9 |
Structure |
|
Synonyms |
2-(chloromethyl)-2-(naphthalen-2-yloxymethyl)propane-1,3-diol |
Molecular Weight |
58.036 g/mol |
Molecular Formula |
C15H17ClO3 |
Canonical SMILES |
C1=CC=C2C=C(C=CC2=C1)OCC(CO)(CO)CCl |
InChI |
InChI=1S/C15H17ClO3/c16-8-15(9-17,10-18)11-19-14-6-5-12-3-1-2-4-13(12)7-14/h1-7,17-18H,8-11H2 |
InChI Key |
PLZJMCNBPWEGNQ-UHFFFAOYSA-N |
Boiling Point |
116 ℃ |
Flash Point |
257.4±28.7 ℃ |
Density |
1.2 g/mL at 25 ℃ |
Appearance |
powder |
Application |
Used to prevent scaling in circulating cooling water systems such as power plants, steel plants, chemical plants, fertilizer plants, refineries and air conditioning systems. |
Storage |
Sealed in a cool, dry environment. |
EC Number |
618-435-5 |
Log P |
4.01 |
logP |
4.01 |
Refractive Index |
1.619 |