| Catalog Number |
ACM9007209-2 |
| CAS |
9007-20-9 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/9007-20-9.gif) |
| Synonyms |
2-(chloromethyl)-2-(naphthalen-2-yloxymethyl)propane-1,3-diol |
| Molecular Weight |
58.036 g/mol |
| Molecular Formula |
C15H17ClO3 |
| Canonical SMILES |
C1=CC=C2C=C(C=CC2=C1)OCC(CO)(CO)CCl |
| InChI |
InChI=1S/C15H17ClO3/c16-8-15(9-17,10-18)11-19-14-6-5-12-3-1-2-4-13(12)7-14/h1-7,17-18H,8-11H2 |
| InChI Key |
PLZJMCNBPWEGNQ-UHFFFAOYSA-N |
| Boiling Point |
116 ℃ |
| Flash Point |
257.4±28.7 ℃ |
| Density |
1.2 g/mL at 25 ℃ |
| Appearance |
powder |
| Application |
Used to prevent scaling in circulating cooling water systems such as power plants, steel plants, chemical plants, fertilizer plants, refineries and air conditioning systems. |
| Storage |
Sealed in a cool, dry environment. |
| EC Number |
618-435-5 |
| Log P |
4.01 |
| logP |
4.01 |
| Refractive Index |
1.619 |