Catalog Number |
ACM765435 |
CAS |
765-43-5 |
Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/765-43-5.gif) |
IUPAC Name |
1-cyclopropylethanone |
Synonyms |
Ethanone, 1-cyclopropyl-;cyclopropyl m-nitrophenyl ketone;cyclopropyl meta-nitrophenyl ketone;acetylcyclopropane;Cyclopropyl methylketone |
Molecular Weight |
84.12g/mol |
Molecular Formula |
C5H8O |
Canonical SMILES |
CC(=O)C1CC1 |
InChI |
InChI=1S/C5H8O/c1-4(6)5-2-3-5/h5H,2-3H2,1H3 |
InChI Key |
HVCFCNAITDHQFX-UHFFFAOYSA-N |
Boiling Point |
111.3 °C |
Melting Point |
<-70ºC |
Flash Point |
21ºC |
Density |
0.903 |
Appearance |
Clear colorless to very slightly yellow liquid |
Complexity |
72 |
Covalently-Bonded Unit Count |
1 |
EC Number |
212-146-4 |
Exact Mass |
84.057514874g/mol |
Heavy Atom Count |
6 |
Hydrogen Bond Acceptor Count |
1 |
Log P |
0.98540 |
MDL Number |
MFCD00001297 |
Monoisotopic Mass |
84.057514874g/mol |
NSC Number |
1940 |
PSA |
17.7 |
Refractive Index |
1.422-1.426 |
Rotatable Bond Count |
1 |
Stability |
Stable under normal temperatures and pressures. |
Topological Polar Surface Area |
17.1Ų |
UNII |
N27YY1XCFH |
WGK Germany |
3 |
X Log P3 |
0.5 |