| Catalog Number |
ACM12609802-1 |
| CAS |
12609-80-2 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/12609-80-2.gif) |
| Synonyms |
Sephadex A 25,2-(diethylamino)ethylether, Diethylaminoethyl Sephadex |
| Molecular Weight |
238.201 g/mol |
| Molecular Formula |
C11H9N3NaO2 |
| Canonical SMILES |
[Na+].OC1=CC(=O)C=C\C1=N/NC1=CC=CC=N1 |
| InChI |
QWZUIMCIEOCSJF-KJEVSKRMSA-N |
| InChI Key |
QWZUIMCIEOCSJF-KJEVSKRMSA-N |
| Appearance |
powder |
| Application |
This product can be used for ion exchange chromatography to purify and separate proteins. |
| Storage |
Sealed in a cool, dry environment. |
| Capacity |
3-4 meq/g ion exchange capacity |
| Compatibility |
Mode of use mixed weak and strong anion exchange chromatography |
| pH |
(working range) 2-9 |
| Pore Size |
~30,000 Da exclusion limit |
| Quality Level |
200 |
| Size |
(bead) 40-125 μm (dry) |
| Stability |
Non-reactive to commonly used aqueous buffers additives such as 8 M urea and 6 M guanidine hydrochloride |