Online Inquiry
11-Dodecenyl acetate
| Catalog Number | ACM35153107-2 |
| CAS | 35153-10-7 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/35153-10-7.gif) |
| IUPAC Name | Dodec-11-enyl acetate |
| Synonyms | 11-Dodecen-1-yl acetate |
| Molecular Weight | 226.35 |
| Molecular Formula | C14H26O2 |
| Canonical SMILES | CC(=O)OCCCCCCCCCCC=C |
| InChI | InChI=1S/C14H26O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h3H,1,4-13H2,2H3 |
| InChI Key | ANBOMSJGDBBKMR-UHFFFAOYSA-N |
| Boiling Point | 279.3 °C at 760 mmHg |
| Flash Point | 116.1 °C |
| Purity | 99%+ |
| Density | 0.876 g/cm3 |
| Application | 11-Dodecenyl Acetate is a sex pheromone that plays a major role in reproduction in plants. |
| Storage | Freezer |
| Complexity | 176 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 226.193280068 |
| Heavy Atom Count | 16 |
| Hydrogen Bond Acceptor Count | 2 |
| Monoisotopic Mass | 226.193280068 |
| References | Inomata, S., et al.: J. Chem. Ecol., 26, 443 (2000); El-Sayed, A., et al.: J. Chem. Ecol., 25, 389 (1999) |
| Rotatable Bond Count | 12 |
| Topological Polar Surface Area | 26.3Ų |
| X Log P3 | 5.1 |
Please kindly note that our products and services are for research use only.