Online Inquiry
E3,Z8,Z11-Tetradecatriene acetate CAS 163041-94-9
| Catalog Number | ACM163041949-5 |
| CAS | 163041-94-9 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/163041-94-9.gif) |
| Synonyms | (3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate [ACD/IUPAC Name] (3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl-acetat [German] [ACD/IUPAC Name] (3E,8Z,11Z)-tetradeca-3,8,11-trienyl acetate 163041-94-9 [RN] 3,8,11-Tetradecatrien-1-ol, acetate, (3E,8Z,11Z)- [ACD/Index Name] Acétate de (3E,8Z,11Z)-3,8,11-tétradécatrién-1-yle [French] [ACD/IUPAC Name] TETRADECA-3,8,11-TRIENYL ACETATE, (3E,8Z,11Z)- (3E,8Z,11Z)-Tetradeca-3,8,11-trien-1-yl acetate [(3E,8Z,11Z)-tetradeca-3,8,11-trienyl] acetate [(3E,8Z,11Z)-tetradeca-3,8,11-trienyl] ethanoate 3,8,11-Tetradecatrien-1-ol, acetate, (3E,8Z,11Z)- (9CI) acetic acid [(3E,8Z,11Z)-tetradeca-3,8,11-trienyl] ester E3,Z8,Z11-Tetradecatriene acetate MFCD22581574 |
| Molecular Weight | 250.376 |
| Molecular Formula | C16H26O2 |
| Canonical SMILES | CC/C=C\C/C=C\CCC/C=C/CCOC(=O)C |
| InChI | InChI=1S/C16H26O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h4-5,7-8,12-13H,3,6,9-11,14-15H2,1-2H3/b5-4-,8-7-,13-12+ |
| InChI Key | HWPJPNQEVWTZSJ-XBZOLNABSA-N |
| Purity | 90% min |
| Appearance | Pale yellow liquid |
| Application | Commonly used as pheromone, used in Tomato leafminer (Scrobipalpuloides absoluta Tuta). |
| Storage | Store in a cold place for long time, sealed and protected from light. |
| MDL Number | MFCD22581574 |
| WGK Germany | 3 |
Please kindly note that our products and services are for research use only.