Ethyl palmitate
| Catalog Number |
ACM628977-1 |
| CAS |
628-97-7 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/628-97-7.gif) |
| IUPAC Name |
Ethyl hexadecanoate |
| Synonyms |
Palmitic acid ethyl ester |
| Molecular Weight |
284.5 |
| Molecular Formula |
C18H36O2 |
| Canonical SMILES |
CCCCCCCCCCCCCCCC(=O)OCC |
| InChI |
InChI=1S/C18H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20-4-2/h3-17H2,1-2H3 |
| InChI Key |
CCCCCCCCCCCCCCCC(=O)OCC |
| Boiling Point |
192-193 °C |
| Melting Point |
24-26 °C |
| Flash Point |
>230 °F |
| Purity |
98%+ |
| Density |
0.857 g/mL at 25 °C(lit.) |
| Solubility |
Soluble in ethanol and oils, insoluble in water |
| Appearance |
White solid @<25°C |
| Exact Mass |
284.271530387 |
| Monoisotopic Mass |
284.271530387 |
| Odor |
Waxy odor |
| Refractive Index |
n20/D 1.440(lit.) |
| Target Pest |
A soft, waxy odor. |
| Topological Polar Surface Area |
26.3 Ų |
Please kindly note that our products and services are for research use only.