Online Inquiry
Hydroxytyrosol
| Catalog Number | ACM10597601 |
| CAS | 10597-60-1 |
| Structure |  |
| IUPAC Name | 4-(2-Hydroxyethyl)benzene-1,2-diol |
| Synonyms | 3,4-Dihydroxyphenylethanol |
| Molecular Weight | 154.16 |
| Molecular Formula | C8H10O3 |
| Canonical SMILES | C1=CC(=C(C=C1CCO)O)O |
| InChI | InChI=1S/C8H10O3/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,9-11H,3-4H2 |
| InChI Key | JUUBCHWRXWPFFH-UHFFFAOYSA-N |
| Boiling Point | 355.4±27.0 °C |
| Purity | 98% |
| Density | 1.321±0.06 g/cm³ |
| Appearance | Solid |
| Storage | -20 °C |
| Complexity | 116 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 154.062994177 |
| Heavy Atom Count | 11 |
| Hydrogen Bond Acceptor Count | 3 |
| Monoisotopic Mass | 154.062994177 |
| Refractive Index | 1.5810-1.5860 |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 60.7 Ų |
| UNII | QEU0NE4O90 |
| X Log P3 | -0.7 |
Please kindly note that our products and services are for research use only.