| Catalog Number |
ACM55505265 |
| CAS |
55505-26-5 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/55505-26-5.gif) |
| IUPAC Name |
8-methylnonan-1-ol |
| Synonyms |
Isodecanol;8-methylnonan-1-ol;8-methyl-1-nonanol;68526-85-2;ISODECYL ALCOHOL;25339-17-7;55505-26-5;1-Nonanol, 8-methyl-;iso-Decylalcohol;UNII-3160X491M7;ISO-DECYL ALCOHOL;Alcohols, C9-11-iso-,C10-rich;C9-11-iso-, C10-rich Alcohols;3160X491M7;8-Methylnonanol;Alcohols, C9-11-branched;HSDB 616;EINECS 246-869-1;EINECS 271-360-6;(C9-11) Branched aliphatic alcohols;8-Methyl-nonan-1-ol;CC(C)CCCCCCC[O];EC 271-360-6;SCHEMBL20345;68551-08-6;DTXSID3058660;ZINC2013559;0582AC;AKOS009031513;LS-13911;DB-055163;AM20120580;FT-0641190;FT-0654308;FT-0672037;526I852;A817796;Q2582737 |
| Molecular Weight |
158.28g/mol |
| Molecular Formula |
C10H22O;C10H21OH;C10H22O |
| Canonical SMILES |
CC(C)CCCCCCCO |
| InChI |
InChI=1S/C10H22O/c1-10(2)8-6-4-3-5-7-9-11/h10-11H,3-9H2,1-2H3 |
| InChI Key |
PLLBRTOLHQQAQQ-UHFFFAOYSA-N |
| Boiling Point |
428 °F at 760 mm Hg (USCG, 1999);220 °C;220 °C |
| Melting Point |
less than 140 °F (USCG, 1999);FP: LESS THAN 140 °F= LESS THAN 60 °C= LESS THAN 333 DEG K;7 °C |
| Flash Point |
220 °F (USCG, 1999);220 °F;104 °C o.c. |
| Density |
0.841 at 68 °F (USCG, 1999);0.8395;Relative density (water = 1): 0.84 |
| Solubility |
Insoluble in water;In water, 150 mg/L at 25 °C (est);Solubility in water, g/100ml: 2.5 |
| Color Form |
Colorless liquid |
| Complexity |
69.3 |
| Covalently-Bonded Unit Count |
1 |
| Decomposition |
When heated to decomposition it emits acrid smoke and irritating fumes. |
| EC Number |
271-234-0;271-360-6;246-869-1 |
| Exact Mass |
158.167065321g/mol |
| Heavy Atom Count |
11 |
| Hydrogen Bond Acceptor Count |
1 |
| Log P |
log Kow = 3.71 (est) |
| Monoisotopic Mass |
158.167065321g/mol |
| Odor |
WEAK ALCOHOLIC |
| Rotatable Bond Count |
7 |
| RTECS Number |
NR0960000 |
| Topological Polar Surface Area |
20.2Ų |
| UNII |
3160X491M7 |
| UN Number |
3082 |
| Vapor Density |
5.5 (AIR= 1);Relative vapor density (air = 1): 5.5 |
| Vapor Pressure |
0.0207 mm Hg at 25 °C;Vapor pressure, kPa at 70 °C: 0.13 |
| X Log P3 |
3.8 |