| Catalog Number |
ACM37220170-16 |
| CAS |
37220-17-0 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/37220-17-0.gif) |
| Synonyms |
Glucomannan (Konjac) Powder |
| Molecular Weight |
492.55 g/mol |
| Molecular Formula |
C21H28N6O6S |
| Canonical SMILES |
COS([O-])(=O)=O.CC(NCC[N+](C)(C)C)C1=CC=C(C=C1)\N=N\C1=CC=C(C=C1C#N)N(=O)=O |
| InChI |
JCDCIALIGLFFJI-XMXXDQCKNA-M |
| InChI Key |
JCDCIALIGLFFJI-XMXXDQCKNA-M |
| Density |
1.471 g/cm3 |
| Solubility |
Soluble in water and insoluble in acetone, chloroform and other organic solvents. |
| Appearance |
White or cream-color powder |
| Application |
Gelling agent; thickener; emulsifier; stabilizer; film-forming agent. |
| Storage |
Sealed in a cool, dry environment |
| EC Number |
253-404-6 |
| pH |
(1%) 5.0-7.5 |
| PSA |
347.83 |
| Size |
powder 40-80 mesh |