Online Inquiry
Methyl 1-Cyclopentene-1-Carboxylate
| Catalog Number | ACM25662286-1 |
| CAS | 25662-28-6 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/25662-28-6.gif) |
| IUPAC Name | methyl cyclopentene-1-carboxylate |
| Synonyms | 25662-28-6;Methyl 1-cyclopentene-1-carboxylate;methyl cyclopent-1-enecarboxylate;methyl cyclopentene-1-carboxylate;Methyl cyclopent-1-ene-1-carboxylate;Cyclopentene-1-carboxylic acid methyl ester;Methyl 1-cyclopentenecarboxylate;1-Cyclopentene-1-carboxylic acid, methyl ester;1-cyclopentenecarboxylic acid methyl ester;MFCD00239506;cyclopent-1-enecarboxylic acid methyl ester;Methyl 1-cyclopentene-1-carboxylate, 97%;1-Cyclopentene-1-carboxylic acid methyl ester;PubChem2487;ACMC-209wal;Methyl 1-cyclopentenoate;1-Cyclopentene-1-carboxylicacid, methyl ester;SCHEMBL44118;AMOT0072;methylcyclopent-1-enecarboxylate;DTXSID10338442;BCP23399;CS-D0999;STR07915;ZINC2561362;ANW-46123;BBL102763;CM0132;STL556569;AKOS009158575;LS20758;MCULE-3606282792;Methyl 1-cyclopentene-1-carboxylate #;AK-39180;N535;SY017441;AB0015853;DB-002203;AM20090313;FT-0675980;ST51038329;M-3493;A817956 |
| Molecular Weight | 126.15 |
| Molecular Formula | C7H10O2 |
| Canonical SMILES | COC(=O)C1=CCCC1 |
| InChI | InChI=1S/C7H10O2/c1-9-7(8)6-4-2-3-5-6/h4H,2-3,5H2,1H3 |
| InChI Key | VTYCAXIAUKEGBQ-UHFFFAOYSA-N |
| Complexity | 147 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 126.068079557g/mol |
| Heavy Atom Count | 9 |
| Hydrogen Bond Acceptor Count | 2 |
| Monoisotopic Mass | 126.068079557g/mol |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 26.3Ų |
| X Log P3 | 1.5 |
Please kindly note that our products and services are for research use only.