Online Inquiry
Methyl (2E,4Z)-2,4-decadienoate
| Catalog Number | ACM4493429-5 |
| CAS | 4493-42-9 |
| Structure |  |
| IUPAC Name | methyl (2E,4Z)-deca-2,4-dienoate |
| Synonyms | Methyl (2E,4Z)-2,4-decadienoate;UNII-WX3M6126GD;methyl (2E,4Z)-deca-2,4-dienoate;methyl (2E,4Z)-decadienoate;E,Z-Methyl 2,4-decadienoate;Methyl (E,Z)-2,4-decadienoate;4493-42-9;Methyl 2,4-decadienoate;WX3M6126GD;2,4-Decadienoic acid, methyl ester, (2E,4Z)-;(2E,4Z)-methyl 2,4-decadienoate;WE(1:0/10:2(2E,4Z));EINECS 224-787-7;Methyl 2,4-decadienoate, (2E,4Z)-;formyl 2E,4Z-decadienoate;Methyl 2E,4Z-decadienoate;SCHEMBL1532560;FEMA 3859;DTXSID60884080;Methyl 2,4 (E,Z)-decadienoate;Ethyl (2E,4Z)-2,4-nonadienoate;LMFA07010479;MFCD00036587;ZINC13433426;Methyl Ester(e,e)-2,4-decadienoic Acid;Methyl ester(E,Z)-2,4-Decadienoic acid;Methyl ester(2E,4Z)-2,4-Decadienoic acid;(2E,4Z)-2,4-Decadienoic Acid Methyl Ester (98%);Q27292986 |
| Molecular Weight | 182.26g/mol |
| Molecular Formula | C11H18O2 |
| Canonical SMILES | CCCCCC=CC=CC(=O)OC |
| InChI | InChI=1S/C11H18O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h7-10H,3-6H2,1-2H3/b8-7-,10-9+ |
| InChI Key | SFHSEXGIVSBRRK-UQGDGPGGSA-N |
| Density | 0.917-0.923 |
| Solubility | not soluble in water;soluble (in ethanol) |
| Complexity | 181 |
| Covalently-Bonded Unit Count | 1 |
| EC Number | 224-787-7 |
| Exact Mass | 182.130679813g/mol |
| Heavy Atom Count | 13 |
| Hydrogen Bond Acceptor Count | 2 |
| Monoisotopic Mass | 182.130679813g/mol |
| Refractive Index | 1.488-1.494 |
| Rotatable Bond Count | 7 |
| Topological Polar Surface Area | 26.3Ų |
| UNII | WX3M6126GD |
| X Log P3 | 3.6 |
Please kindly note that our products and services are for research use only.