Online Inquiry
Methyl 5-hexynoate
| Catalog Number | ACM77758511-1 |
| CAS | 77758-51-1 |
| Structure |  |
| IUPAC Name | methyl hex-5-ynoate |
| Synonyms | Methyl 5-hexynoate;methyl hex-5-ynoate;77758-51-1;5-Hexynoic acid, methyl ester;5-hexynoic acid methyl ester;MFCD00671366;Hex-5-ynoic acid methyl ester;Methyl 5-hexynoate, 95%;Methyl 5-hexynoate #;PROCATEROLHYDROCHLORIDE;SCHEMBL1444871;Hex-5-ynoic acid, methyl ester;Methyl 5-hexynoate, AldrichCPR;BCP22814;ZINC2567249;AS-57079;SY275105;CS-0127624;FT-0740703 |
| Molecular Weight | 126.15g/mol |
| Molecular Formula | C7H10O2 |
| Canonical SMILES | COC(=O)CCCC#C |
| InChI | InChI=1S/C7H10O2/c1-3-4-5-6-7(8)9-2/h1H,4-6H2,2H3 |
| InChI Key | LZULAZTXJLWELL-UHFFFAOYSA-N |
| Complexity | 129 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 126.068079557g/mol |
| Heavy Atom Count | 9 |
| Hydrogen Bond Acceptor Count | 2 |
| Monoisotopic Mass | 126.068079557g/mol |
| Rotatable Bond Count | 4 |
| Topological Polar Surface Area | 26.3Ų |
| X Log P3 | 1.3 |
Please kindly note that our products and services are for research use only.