| Catalog Number |
ACM9041376-1 |
| CAS |
9041-37-6 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/9041-37-6.gif) |
| Synonyms |
Sephadex LH-20 |
| Molecular Weight |
224.24 g/mol |
| Molecular Formula |
C9H8N2O3S |
| Canonical SMILES |
CC(=O)N1C2=C(C=N1)SC(=C2)C(=O)OC |
| InChI |
InChI=1S/C9H8N2O3S/c1-5(12)11-6-3-7(9(13)14-2)15-8(6)4-10-11/h3-4H,1-2H3 |
| InChI Key |
XELZGAJCZANUQH-UHFFFAOYSA-N |
| Application |
Sephadex LH-20 can be used to separate cholesterol, fatty acids, hormones, vitamins, natural products, etc. |
| Storage |
Sealed in a cool, dry environment |
| Log P |
1.4 |
| logP |
1.4 |
| PSA |
89.4 |
| Size |
Dry powder 18-111μm |