Online Inquiry
N-Heptafluorobutyrylimidazole
| Catalog Number | ACM32477353 |
| CAS | 32477-35-3 |
| Structure |  |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-imidazol-1-ylbutan-1-one |
| Synonyms | 1-(Perfluorobutyryl)imidazole, NSC 151966 |
| Molecular Weight | 264.1 |
| Molecular Formula | C7H3F7N2O |
| Canonical SMILES | C1=CN(C=N1)C(=O)C(C(C(F)(F)F)(F)F)(F)F |
| InChI | InChI=1S/C7H3F7N2O/c8-5(9,6(10,11)7(12,13)14)4(17)16-2-1-15-3-16/h1-3H |
| InChI Key | MSYHGYDAVLDKCE-UHFFFAOYSA-N |
| Boiling Point | 161 °C (lit.) |
| Melting Point | 41895ºC |
| Flash Point | 77ºC |
| Purity | 97% |
| Density | 1.49 |
| Appearance | clear, colorless liquid |
| Complexity | 314 |
| Covalently-Bonded Unit Count | 1 |
| EC Number | 251-063-8 |
| Exact Mass | 264.01335986g/mol |
| Hazard Statements | Xi:Irritant; |
| Heavy Atom Count | 17 |
| Hydrogen Bond Acceptor Count | 9 |
| Monoisotopic Mass | 264.01335986g/mol |
| NSC Number | 151966 |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 34.9Ų |
| WGK Germany | 3 |
| X Log P3 | 2.4 |
Please kindly note that our products and services are for research use only.