Online Inquiry
N,O-Bis(trimethylsilyl)acetamide
| Catalog Number | ACM10416598 |
| CAS | 10416-59-8 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/10416-59-8.gif) |
| IUPAC Name | trimethylsilyl N-trimethylsilylethanimidate |
| Synonyms | BSA |
| Molecular Weight | 203.43 |
| Molecular Formula | C8H21NOSi2 |
| Canonical SMILES | CC(=N[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C8H21NOSi2/c1-8(9-11(2,3)4)10-12(5,6)7/h1-7H3 |
| InChI Key | SIOVKLKJSOKLIF-UHFFFAOYSA-N |
| Boiling Point | 71-73 °C/35 mmHg (lit.) |
| Melting Point | 24 °C |
| Flash Point | 44 °C - closed cup |
| Purity | 95% |
| Density | 0.832 g/mL at 20 °C (lit.) |
| Appearance | Colour less Oil |
| Storage | Keep Cold. Moisture Sensitive. |
| Complexity | 177 |
| Covalently-Bonded Unit Count | 1 |
| EC Number | 233-892-7 |
| Exact Mass | 203.11616736g/mol |
| Heavy Atom Count | 12 |
| Hydrogen Bond Acceptor Count | 2 |
| Monoisotopic Mass | 203.11616736g/mol |
| Refractive Index | 1.4165-1.4185 |
| Rotatable Bond Count | 3 |
| Topological Polar Surface Area | 21.6Ų |
Please kindly note that our products and services are for research use only.