| Catalog Number |
ACM142507-1 |
| CAS |
142-50-7 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/acm142507.gif) |
| IUPAC Name |
(3S,6Z)-3,7,11-Trimethyldodeca-1,6,10-trien-3-ol |
| Synonyms |
Peruviol |
| Molecular Weight |
222.37 |
| Molecular Formula |
C15H26O |
| Canonical SMILES |
CC(=CCCC(=CCCC(C)(C=C)O)C)C |
| InChI |
InChI=1S/C15H26O/c1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3/h6,9,11,16H,1,7-8,10,12H2,2-5H3/b14-11-/t15-/m1/s1 |
| InChI Key |
FQTLCLSUCSAZDY-QKXCFHHRSA-N |
| Complexity |
269 |
| Exact Mass |
222.198365449 |
| Heavy Atom Count |
16 |
| Monoisotopic Mass |
222.198365449 |
| Topological Polar Surface Area |
20.2Ų |