| Catalog Number |
ACM2444464 |
| CAS |
2444-46-4 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/2444-46-4.gif) |
| IUPAC Name |
N-[(4-Hydroxy-3-methoxyphenyl)methyl]nonanamide |
| Synonyms |
N-Nonanoyl vanillylamide |
| Molecular Weight |
293.4 |
| Molecular Formula |
C17H27NO3 |
| Canonical SMILES |
CCCCCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
| InChI |
InChI=1S/C17H27NO3/c1-3-4-5-6-7-8-9-17(20)18-13-14-10-11-15(19)16(12-14)21-2/h10-12,19H,3-9,13H2,1-2H3,(H,18,20) |
| InChI Key |
RGOVYLWUIBMPGK-UHFFFAOYSA-N |
| Boiling Point |
200-210 °C |
| Melting Point |
54 °C |
| Flash Point |
190 °C |
| Purity |
95%+ |
| Density |
1.1 g/cm³ |
| Solubility |
Slightly soluble in water |
| Appearance |
White to off-white powder |
| Storage |
Sealed in dry, 2-8 °C |
| Complexity |
283 |
| EC Number |
219-484-1 |
| Exact Mass |
293.19909372 |
| Hazard Statements |
T,Xi |
| Log P |
4.38 |
| Monoisotopic Mass |
293.19909372 |
| PSA |
58.56000 |
| Refractive Index |
1.513 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Symbol |
GHS07 |
| Topological Polar Surface Area |
58.6 Ų |
| Vapor Pressure |
0.0±1.2 mmHg at 25°C |
| WGK Germany |
3 |