Octadecyl acetate
| Catalog Number |
ACM822231-1 |
| CAS |
822-23-1 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/822-23-1.gif) |
| IUPAC Name |
octadecyl acetate |
| Synonyms |
octadecyl acetate;18:Ac; |
| Molecular Weight |
312.538 |
| Molecular Formula |
C20H40O2 |
| Canonical SMILES |
CCCCCCCCCCCCCCCCCCOC(=O)C |
| InChI |
InChI=1S/C20H40O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20(2)21/h3-19H2,1-2H3 |
| InChI Key |
OIZXRZCQJDXPFO-UHFFFAOYSA-N |
| Flash Point |
156.5°C |
| Density |
0.862 g/cm³ |
| Solubility |
water, 0.0003691 mg/L @ 25 °C (est) |
| Appearance |
White to pale yellow waxy solid (est) |
| EC Number |
212-493-1 |
| MDL Number |
MFCD00043649 |
| Refractive Index |
1.445 |
Please kindly note that our products and services are for research use only.