Online Inquiry
Oxazole-4-carboxylic acid
| Catalog Number | ACM23012137-2 |
| CAS | 23012-13-7 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/23012-13-7.gif) |
| IUPAC Name | 1,3-oxazole-4-carboxylic acid |
| Synonyms | 1,3-Oxazole-4-carboxylic acid |
| Molecular Weight | 113.0726 |
| Molecular Formula | C4H3NO3 |
| InChI | InChI=1S/C4H3NO3/c6-4(7)3-1-8-2-5-3/h1-2H,(H,6,7) |
| InChI Key | JBCFJMYPJJWIRG-UHFFFAOYSA-N |
| Boiling Point | 142 °C |
| Melting Point | 142 °C |
| Purity | 96% |
| Appearance | Dark yellow solid |
| Complexity | 104 |
| Covalently-Bonded Unit Count | 1 |
| Exact Mass | 113.011292958g/mol |
| Heavy Atom Count | 8 |
| Hydrogen Bond Acceptor Count | 4 |
| MDL Number | MFCD06797151 |
| Monoisotopic Mass | 113.011292958g/mol |
| Rotatable Bond Count | 1 |
| Size | 1g,5g,25g,100g |
| Topological Polar Surface Area | 63.3Ų |
| X Log P3 | 0.2 |
Please kindly note that our products and services are for research use only.