2-Phenylethyl propionate
| Catalog Number |
ACM122703-1 |
| CAS |
122-70-3 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/acm122703.gif) |
| IUPAC Name |
2-Phenylethyl propanoate |
| Synonyms |
Phenethyl propionate |
| Molecular Weight |
178.23 |
| Molecular Formula |
C11H14O2 |
| Canonical SMILES |
CCC(=O)OCCC1=CC=CC=C1 |
| InChI |
InChI=1S/C11H14O2/c1-2-11(12)13-9-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChI Key |
HVGZQCSMLUDISR-UHFFFAOYSA-N |
| Complexity |
148 |
| Exact Mass |
178.099379685 |
| Heavy Atom Count |
13 |
| Monoisotopic Mass |
178.099379685 |
| Topological Polar Surface Area |
26.3Ų |
Please kindly note that our products and services are for research use only.