Pyraclostrobin
| Catalog Number |
ACM175013180 |
| CAS |
175013-18-0 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/175013-18-0.gif) |
| Synonyms |
N-[2-[[[1-(4-Chlorophenyl)-1H-pyrazol-3-yl]oxy]methyl]phenyl]-N-methoxycarbamic Acid Methyl Ester; [2-[[[1-(4-Chlorophenyl)-1H-pyrazol-3-yl]oxy]methyl]phenyl]methoxycarbamic Acid Methyl Ester; BAS 500F; Cabrio; Comet; F 500; F 500; Headline; Stamina |
| Molecular Weight |
387.82 |
| Molecular Formula |
C19H18ClN3O4 |
| Canonical SMILES |
COC(N(C1=C(C=CC=C1)COC2=NN(C3=CC=C(Cl)C=C3)C=C2)OC)=O |
| Melting Point |
63-67 ºC |
| Purity |
98.0% |
| Appearance |
white/grey crystals |
| Application |
Pyraclostrobin is a new broad spectrum foliar fungicide in the strobilurin chemical class. |
| Storage |
room temperature |
Please kindly note that our products and services are for research use only.