| Catalog Number |
ACM83382892-1 |
| CAS |
83382-89-2 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/83382-89-2.gif) |
| Synonyms |
Diethyl-(2-hydroxypropyl)aminoethyl Sephadex |
| Molecular Weight |
186.158 g/mol |
| Molecular Formula |
C9H8F2O2 |
| Canonical SMILES |
CC(=O)C1=CC=C(OC(F)F)C=C1 |
| InChI |
GIGWRVLNOYPOIT-UHFFFAOYSA-N |
| InChI Key |
GIGWRVLNOYPOIT-UHFFFAOYSA-N |
| Appearance |
powder |
| Application |
It is used in protein chromatography, ion exchange chromatography, anion exchange media, resins and separation media. |
| Storage |
Sealed in a cool, dry environment. |
| Capacity |
2.6-3.4 meq/g ion exchange capacity |
| Compatibility |
mode of use strong anion exchange chromatography |
| MDL Number |
MFCD00132780 |
| pH |
(working range) 2-10 |
| Pore Size |
~200,000 Da exclusion limit |
| Quality Level |
200 |
| Size |
(bead) 40-125 μm (dry) |