| Catalog Number |
ACM127479-2 |
| CAS |
127-47-9 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/127-47-9.gif) |
| Synonyms |
[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] acetate |
| Molecular Weight |
328.496 g/mol |
| Molecular Formula |
C22H32O2 |
| Canonical SMILES |
CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/COC(=O)C)/C)/C |
| InChI |
InChI=1S/C22H32O2/c1-17(9-7-10-18(2)14-16-24-20(4)23)12-13-21-19(3)11-8-15-22(21,5)6/h7,9-10,12-14H,8,11,15-16H2,1-6H3/b10-7+,13-12+,17-9+,18-14+ |
| InChI Key |
QGNJRVVDBSJHIZ-QHLGVNSISA-N |
| Boiling Point |
440.5 ℃ at 760 mmHg |
| Melting Point |
58 ℃ |
| Flash Point |
124.8 ℃ |
| Density |
0.968 g/cm3 |
| Solubility |
Insoluble in water, but soluble in ether, ethanol, petroleum ether, chloroform and vegetable oil. |
| Appearance |
Yellow crystalline powder |
| Application |
It can be absorbed through the skin, resist keratinization, stimulate the growth of collagen and elastin, and increase the thickness of the epidermis and dermis. Enhance skin elasticity, effectively eliminate wrinkles, promote skin renewal, and maintain skin vitality. Used in eye cream, moisturizer, repair cream, shampoo, conditioner, etc. |
| Storage |
Sealed in a cool, dry environment. |
| EC Number |
204-844-2 |
| Log P |
6.0811 |
| logP |
6.0811 |
| Odor |
Amine like |
| PSA |
26.3 |
| Refractive Index |
1.547-1.555 |
| Storage Temperature |
2-8 ℃ |
| Vapor Pressure |
0.0±1.1 mmHg at 25°C |