Sephadex G-50
| Catalog Number |
ACM9048719-1 |
| CAS |
9048-71-9 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/9048-71-9.gif) |
| Molecular Weight |
238.201 g/mol |
| Molecular Formula |
C11H9N3NaO2 |
| Canonical SMILES |
[Na+].OC1=CC(=O)C=C\C1=N/NC1=CC=CC=N1 |
| InChI |
QWZUIMCIEOCSJF-KJEVSKRMSA-N |
| InChI Key |
QWZUIMCIEOCSJF-KJEVSKRMSA-N |
| Appearance |
powder |
| Application |
This product can be used for gel permeation chromatography to separate glycopeptide mixtures. |
| Storage |
Sealed in a cool, dry environment. |
| Quality Level |
200 |
| Size |
(bead) 20-80 μm |
| Swelling |
1 g swells to 9-11 mL |
Please kindly note that our products and services are for research use only.