| Catalog Number |
ACM9050684-1 |
| CAS |
9050-68-4 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/9050-68-4.gif) |
| Synonyms |
2-[2-(4-bromopyrazol-1-yl)ethyl]isoindole-1,3-dione |
| Molecular Weight |
320.1414 g/mol |
| Molecular Formula |
C13H10BrN3O2 |
| Canonical SMILES |
C1=CC=C2C(=C1)C(=O)N(C2=O)CCN3C=C(C=N3)Br |
| InChI |
InChI=1S/C13H10BrN3O2/c14-9-7-15-16(8-9)5-6-17-12(18)10-3-1-2-4-11(10)13(17)19/h1-4,7-8H,5-6H2 |
| InChI Key |
WFIYPADYPQQLNN-UHFFFAOYSA-N |
| Boiling Point |
461.1±25.0 ℃ at 760 mmHg |
| Flash Point |
232.7±23.2 ℃ |
| Density |
1.7±0.1 g/cm3 |
| Appearance |
powder |
| Application |
This product is a gel filtration media used in gel filtration chromatography and protein chromatography. |
| Storage |
Sealed in a cool, dry environment. |
| Log P |
2.94 |
| logP |
2.94 |
| PSA |
55.2 |
| Quality Level |
200 |
| Refractive Index |
1.721 |
| Swelling |
1 g swells to 2-3 mL |
| Vapor Pressure |
0.0±1.1 mmHg at 25 ℃ |