| Catalog Number |
ACM822231 |
| CAS |
822-23-1 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/822-23-1.gif) |
| IUPAC Name |
Octadecyl acetate |
| Synonyms |
Octadecyl Acetate |
| Molecular Weight |
312.53 |
| Molecular Formula |
C20H40O2 |
| Canonical SMILES |
CCCCCCCCCCCCCCCCCCOC(=O)C |
| InChI |
OIZXRZCQJDXPFO-UHFFFAOYSA-N |
| InChI Key |
InChI=1S/C20H40O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20(2)21/h3-19H2,1-2H3 |
| Boiling Point |
352 °C |
| Melting Point |
33 °C |
| Flash Point |
156.5ºC |
| Purity |
99%+ |
| Density |
0.87g/ml |
| Solubility |
Chloroform (Sparingly), Methanol (Slightly) |
| Appearance |
White to Off-White Low-Melting Solid |
| Application |
Stearyl Acetate is a sex pheromone found in the males of the castniid palm borer, paysandisia exhibited in their courtship behavior. |
| Storage |
Refrigerator |
| EC Number |
212-493-1 |
| Exact Mass |
312.30300 |
| References |
Quero, C., et al.: PLoS One, 12, 0171166 (2017) |
| WGK Germany |
3 |