Online Inquiry
Tetrabutylammonium Hexafluorophosphate
| Catalog Number | ACM3109635 |
| CAS | 3109-63-5 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/3109-63-5.gif) |
| IUPAC Name | tetrabutylazanium;hexafluorophosphate |
| Synonyms | Tetra-N-Butylammonium hexafluorophosphate |
| Molecular Weight | 387.43 |
| Molecular Formula | C16H36F6NP |
| Canonical SMILES | CCCC[N+](CCCC)(CCCC)CCCC.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C16H36N.F6P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-7(2,3,4,5)6/h5-16H2,1-4H3;/q+1;-1 |
| InChI Key | BKBKEFQIOUYLBC-UHFFFAOYSA-N |
| Boiling Point | 242-246 °C |
| Melting Point | 242-248 °C |
| Purity | ≥98% |
| Solubility | soluble in Methanol |
| Appearance | Powder |
| Storage | Store under inert gas |
| Complexity | 179 |
| Covalently-Bonded Unit Count | 2 |
| EC Number | 221-472-6 |
| Exact Mass | 387.24895612 |
| Hazard Statements | H315 : Causes skin irritation.H319 : Causes serious eye irritation. |
| Heavy Atom Count | 24 |
| Hydrogen Bond Acceptor Count | 7 |
| MDL Number | MFCD00011748 |
| Monoisotopic Mass | 387.24895612 |
| Refractive Index | 1.42 |
| Rotatable Bond Count | 12 |
| Topological Polar Surface Area | 0 Ų |
| WGK Germany | 3 |
Please kindly note that our products and services are for research use only.