Online Inquiry
4,5,6,7-Tetrahydro-benzo[b]thiophene-2-carboxylic acid
| Catalog Number | ACM40133071 |
| CAS | 40133-07-1 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/40133-07-1.gif) |
| IUPAC Name | 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid |
| Synonyms | Enamine_001826, Oprea1_686622, MLS000096433, MolPort-000-888-951, STK349487, HMS1399C22, ALBB-000244, SMR000061095, CID2063443, BAS 13134257, 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylic acid, 4,5,6,7-Tetrahydro-benzo[b]thiophene-2-carboxylic acid, 40133-07-1 |
| Molecular Weight | 182.24 |
| Molecular Formula | C9H10O2S |
| Canonical SMILES | C1CCC2=C(C1)C=C(S2)C(=O)O |
| InChI Key | ROLXOQXKNDKXTA-UHFFFAOYSA-N |
| Boiling Point | 368.1ºC at 760mmHg |
| Flash Point | 176.4ºC |
| Purity | 96% |
| Exact Mass | 182.04000 |
Please kindly note that our products and services are for research use only.