Online Inquiry
trans-Cinnamic Acid
| Catalog Number | ACM140103-2 |
| CAS | 140-10-3 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/140-10-3.gif) |
| IUPAC Name | (E)-3-Phenylprop-2-enoic acid |
| Synonyms | Benzalaceticacid |
| Molecular Weight | 148.16 |
| Molecular Formula | C9H8O2 |
| Canonical SMILES | C1=CC=C(C=C1)C=CC(=O)O |
| InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
| InChI Key | WBYWAXJHAXSJNI-VOTSOKGWSA-N |
| Boiling Point | 300 °C(lit.) |
| Melting Point | 133 °C(lit.) |
| Flash Point | >230 °F |
| Purity | 99%+ |
| Density | 1.248 g/cm³ |
| Solubility | Insoluble in water, soluble in oils |
| Appearance | Solid |
| Application | Plant Growth Regulator |
| Storage | 2-8 °C |
| Complexity | 155 |
| Exact Mass | 148.052429494 |
| Form | Powder |
| Monoisotopic Mass | 148.052429494 |
| Notes | Plant Tissue Culture Tested |
| Pack Size | 25g |
| pH | 3-4 (0.4g/l, H₂O, 20°C) |
| Refractive Index | 1.5049 |
| Stability | Stable under normal temperatures and pressures. |
| Storage Temperature | Room Temperature |
| Topological Polar Surface Area | 37.3 Ų |
Please kindly note that our products and services are for research use only.