Catalog Number |
ACM554687 |
CAS |
554-68-7 |
Structure |
|
IUPAC Name |
N,N-Diethylethanamine;hydrochloride |
Synonyms |
Ethanamine,N,N-diethyl-,hydrochloride |
Molecular Weight |
137.65 |
Molecular Formula |
C6H16ClN |
Canonical SMILES |
CCN(CC)CC.Cl |
InChI |
InChI=1S/C6H15N.ClH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H |
InChI Key |
ILWRPSCZWQJDMK-UHFFFAOYSA-N |
Melting Point |
261 °C |
Purity |
98%+ |
Appearance |
colourless hygroscopic powder |
Application |
Triethylamine is used in mosquito and vector control labs to anaesthetise mosquitoes. This is done to preserve any viral material that might be present during species identification. |
Storage |
Room temperature |
Complexity |
25.7 |
Covalently-Bonded Unit Count |
2 |
Exact Mass |
137.0971272 |
Hazard Statements |
H300-H315-H318-H335 |
Heavy Atom Count |
8 |
Hydrogen Bond Acceptor Count |
1 |
Monoisotopic Mass |
137.0971272 |
Rotatable Bond Count |
3 |
Symbol |
GHS05 |
Topological Polar Surface Area |
3.2 Ų |