| Catalog Number |
ACM554687 |
| CAS |
554-68-7 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/554-68-7.gif) |
| IUPAC Name |
N,N-Diethylethanamine;hydrochloride |
| Synonyms |
Ethanamine,N,N-diethyl-,hydrochloride |
| Molecular Weight |
137.65 |
| Molecular Formula |
C6H16ClN |
| Canonical SMILES |
CCN(CC)CC.Cl |
| InChI |
InChI=1S/C6H15N.ClH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H |
| InChI Key |
ILWRPSCZWQJDMK-UHFFFAOYSA-N |
| Melting Point |
261 °C |
| Purity |
98%+ |
| Appearance |
colourless hygroscopic powder |
| Application |
Triethylamine is used in mosquito and vector control labs to anaesthetise mosquitoes. This is done to preserve any viral material that might be present during species identification. |
| Storage |
Room temperature |
| Complexity |
25.7 |
| Covalently-Bonded Unit Count |
2 |
| Exact Mass |
137.0971272 |
| Hazard Statements |
H300-H315-H318-H335 |
| Heavy Atom Count |
8 |
| Hydrogen Bond Acceptor Count |
1 |
| Monoisotopic Mass |
137.0971272 |
| Rotatable Bond Count |
3 |
| Symbol |
GHS05 |
| Topological Polar Surface Area |
3.2 Ų |