Online Inquiry
Triphenylfluorosilane
| Catalog Number | ACM379500 |
| CAS | 379-50-0 |
| Structure | ![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/379-50-0.gif) |
| IUPAC Name | fluoro-tri(phenyl)silane |
| Synonyms | Triphenylfluorosilane, Fluorotriphenylsilane, Silane, fluorotriphenyl-, Triphenylsilyl fluoride, 440760_ALDRICH, NSC43086, EINECS 206-832-2, NSC139863, NSC 139863, 379-50-0 |
| Molecular Weight | 278.4 g/mol |
| Molecular Formula | C18H15FSi |
| Canonical SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)F |
| InChI Key | UBGXLEFOIVWVRP-UHFFFAOYSA-N |
| Boiling Point | 347.3 °C(760 mmHg) |
| Melting Point | 62-64 °C(lit.) |
| Flash Point | 163.8 °C |
| Purity | 95%+ |
| Density | 1,212 g/mL |
| Appearance | Transparent liquid |
| EC Number | 206-832-2 |
| Exact Mass | 278.09300 |
| Hazard Statements | Xi: Irritant;C: Corrosive; |
| WGK Germany | 3 |
Please kindly note that our products and services are for research use only.