Z-7-Hexadecenyl acetate
| Catalog Number |
ACM23192429 |
| CAS |
23192-42-9 |
| Structure |
![{[CurrentData.Name]}](https://resource.alfa-chemistry.com/structure/23192-42-9.gif) |
| IUPAC Name |
[(Z)-hexadec-7-enyl] acetate |
| Synonyms |
hexadec-7-enyl acetate;7Z-16Ac; |
| Molecular Weight |
282.468 |
| Molecular Formula |
C18H34O2 |
| Canonical SMILES |
CCCCCCCCC=CCCCCCCOC(=O)C |
| InChI |
InChI=1S/C18H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h10-11H,3-9,12-17H2,1-2H3/b11-10- |
| InChI Key |
QVXFGVVYTKZLJN-KHPPLWFESA-N |
| Boiling Point |
365ºC at 760 mmHg |
| Flash Point |
98.7ºC |
| Purity |
98% |
| Density |
0.875g/cm³ |
| EC Number |
245-480-4 |
| Exact Mass |
282.25600 |
Please kindly note that our products and services are for research use only.